| MolName | (Z)-(3,4-dichlorophenyl)methylidenehydrazine |
| MolecularFormula | C7H6N2Cl2 |
| Smiles | N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C7H6Cl2N2/c8-6-2-1-5(4-11-10)3-7(6)9/h1-4H,10H2 |
| InChIK | YQLRALIFVMSFSX-UHFFFAOYSA-N |
| TotalMolweight | 189.045 |
| Molweight | 189.045 |
| MonoisotopicMass | 187.990802 |
| CLogP | 2.7788 |
| CLogS | -3.865 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 137.38 |
| Relative PSA | 0.19493 |
| PolarSurfaceArea | 38.38 |
| Druglikeness | -2.2718 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.72727 |
| Fragments | 1 |
| Non HAtoms | 11 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 1 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-(3,4-dichlorophenyl)methylidenehydrazine | 2 - (Z)-(3,4-dichlorophenyl)methylidenehydrazine