| MolName | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
| MolecularFormula | C23H18N5OFS |
| Smiles | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C23H18FN5OS/c24-20-14-8-7-11-18(20)15-25-26-21(30)16-31-23-28-27-22(17-9-3-1-4-10-17)29(23)19-12-5-2-6-13-19/h1-15H,16H2,(H,26,30) |
| InChIK | YRCCRYHUFNLYHV-UHFFFAOYSA-N |
| TotalMolweight | 431.494 |
| Molweight | 431.494 |
| MonoisotopicMass | 431.121608 |
| CLogP | 4.6326 |
| CLogS | -8.73 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 330.83 |
| Relative PSA | 0.2488 |
| PolarSurfaceArea | 97.47 |
| Druglikeness | 4.0855 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide | 2 - 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide