| MolName | N-[(Z)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-cyanoacetamide |
| MolecularFormula | C18H14N4O3ClF |
| Smiles | N#CCC(N/N=C\c(cc1)cc(Cl)c1OCC(Nc(cccc1)c1F)=O)=O |
| InChI | InChI=1S/C18H14ClFN4O3/c19-13-9-12(10-22-24-17(25)7-8-21)5-6-16(13)27-11-18(26)23-15-4-2-1-3-14(15)20/h1-6,9-10H,7,11H2,(H,23,26)(H,24,25) |
| InChIK | YRNJBRQZAQMLFZ-UHFFFAOYSA-N |
| TotalMolweight | 388.785 |
| Molweight | 388.785 |
| MonoisotopicMass | 388.073846 |
| CLogP | 2.887 |
| CLogS | -5.311 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 297.2 |
| Relative PSA | 0.28287 |
| PolarSurfaceArea | 103.58 |
| Druglikeness | -3.8718 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-cyanoacetamide | 2 - N-[(Z)-[3-chloro-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-cyanoacetamide