| MolName | 2-(2-fluorophenoxy)-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide |
| MolecularFormula | C17H18N3O3FS |
| Smiles | O=C(COc(cccc1)c1F)N/N=C\c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C17H18FN3O3S/c18-14-3-1-2-4-15(14)24-12-16(22)20-19-11-13-5-6-17(25-13)21-7-9-23-10-8-21/h1-6,11H,7-10,12H2,(H,20,22) |
| InChIK | YRRMZQZKDMLNDF-UHFFFAOYSA-N |
| TotalMolweight | 363.412 |
| Molweight | 363.412 |
| MonoisotopicMass | 363.10529 |
| CLogP | 2.6025 |
| CLogS | -4.078 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 274.88 |
| Relative PSA | 0.29075 |
| PolarSurfaceArea | 91.4 |
| Druglikeness | 5.0885 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-fluorophenoxy)-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide | 2 - 2-(2-fluorophenoxy)-N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]acetamide