| MolName | N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-2-(4-iodophenoxy)acetamide |
| MolecularFormula | C13H9N2O3Br2I |
| Smiles | O=C(COc(cc1)ccc1I)N/N=C\c(o1)cc(Br)c1Br |
| InChI | InChI=1S/C13H9Br2IN2O3/c14-11-5-10(21-13(11)15)6-17-18-12(19)7-20-9-3-1-8(16)2-4-9/h1-6H,7H2,(H,18,19) |
| InChIK | YSLXDPPEHCFKBB-UHFFFAOYSA-N |
| TotalMolweight | 527.933 |
| Molweight | 527.933 |
| MonoisotopicMass | 525.802463 |
| CLogP | 3.9501 |
| CLogS | -5.63 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 263.98 |
| Relative PSA | 0.22774 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | -0.50847 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | 1,2-dihalo-alkene; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-2-(4-iodophenoxy)acetamide | 2 - N-[(Z)-(4,5-dibromofuran-2-yl)methylideneamino]-2-(4-iodophenoxy)acetamide