| MolName | 2-pyridin-1-ium-1-yl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C12H12N3OS |
| Smiles | O=C(C[n+]1ccccc1)N/N=C\c1cccs1 |
| InChI | InChI=1S/C12H11N3OS/c16-12(10-15-6-2-1-3-7-15)14-13-9-11-5-4-8-17-11/h1-9H,10H2/p+1 |
| InChIK | YSTUOSMXAVLEBN-UHFFFAOYSA-O |
| TotalMolweight | 246.313 |
| Molweight | 246.313 |
| MonoisotopicMass | 246.070107 |
| CLogP | -2.3617 |
| CLogS | -2.066 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 193.99 |
| Relative PSA | 0.30481 |
| PolarSurfaceArea | 73.58 |
| Druglikeness | 5.6949 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-pyridin-1-ium-1-yl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-pyridin-1-ium-1-yl-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide