| MolName | 4-(4-bromophenyl)-N-[(E)-(3-phenoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C22H16N3OBrS |
| Smiles | Brc(cc1)ccc1-c1csc(N/N=C/c2cc(Oc3ccccc3)ccc2)n1 |
| InChI | InChI=1S/C22H16BrN3OS/c23-18-11-9-17(10-12-18)21-15-28-22(25-21)26-24-14-16-5-4-8-20(13-16)27-19-6-2-1-3-7-19/h1-15H,(H,25,26) |
| InChIK | YSVJVQXSWHJHNC-UHFFFAOYSA-N |
| TotalMolweight | 450.359 |
| Molweight | 450.359 |
| MonoisotopicMass | 449.019743 |
| CLogP | 8.3372 |
| CLogS | -7.791 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 312.09 |
| Relative PSA | 0.20603 |
| PolarSurfaceArea | 74.75 |
| Druglikeness | 1.9975 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(4-bromophenyl)-N-[(E)-(3-phenoxyphenyl)methylideneamino]-1,3-thiazol-2-amine | 2 - 4-(4-bromophenyl)-N-[(E)-(3-phenoxyphenyl)methylideneamino]-1,3-thiazol-2-amine