| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-3-fluorobenzamide |
| MolecularFormula | C22H15N2OF |
| Smiles | O=C(c1cccc(F)c1)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C22H15FN2O/c23-18-9-5-8-17(13-18)22(26)25-24-14-21-19-10-3-1-6-15(19)12-16-7-2-4-11-20(16)21/h1-14H,(H,25,26) |
| InChIK | YTAYMPKZXNFULK-UHFFFAOYSA-N |
| TotalMolweight | 342.372 |
| Molweight | 342.372 |
| MonoisotopicMass | 342.116841 |
| CLogP | 5.6912 |
| CLogS | -7.247 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 262.54 |
| Relative PSA | 0.13716 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 3.1287 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-3-fluorobenzamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-3-fluorobenzamide