| MolName | N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]acetamide |
| MolecularFormula | C21H21N4O5Cl |
| Smiles | [O-][N+](c(cc(/C=N\NC(CNC(COc1cc(CCCC2)c2cc1)=O)=O)cc1)c1Cl)=O |
| InChI | InChI=1S/C21H21ClN4O5/c22-18-8-5-14(9-19(18)26(29)30)11-24-25-20(27)12-23-21(28)13-31-17-7-6-15-3-1-2-4-16(15)10-17/h5-11H,1-4,12-13H2,(H,23,28)(H,25,27) |
| InChIK | YTGBUFXPDKHRQH-UHFFFAOYSA-N |
| TotalMolweight | 444.874 |
| Molweight | 444.874 |
| MonoisotopicMass | 444.120048 |
| CLogP | 2.7014 |
| CLogS | -5.556 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 334.35 |
| Relative PSA | 0.30187 |
| PolarSurfaceArea | 125.61 |
| Druglikeness | -5.1481 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64516 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]acetamide | 2 - N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]acetamide