| MolName | (5Z)-5-benzylidene-3-[(Z)-benzylideneamino]-2-phenylimidazol-4-one |
| MolecularFormula | C23H17N3O |
| Smiles | O=C(/C(/N=C1c2ccccc2)=C/c2ccccc2)N1/N=C\c1ccccc1 |
| InChI | InChI=1S/C23H17N3O/c27-23-21(16-18-10-4-1-5-11-18)25-22(20-14-8-3-9-15-20)26(23)24-17-19-12-6-2-7-13-19/h1-17H |
| InChIK | YTOZPDOTYJJSAD-UHFFFAOYSA-N |
| TotalMolweight | 351.408 |
| Molweight | 351.408 |
| MonoisotopicMass | 351.137162 |
| CLogP | 4.3593 |
| CLogS | -5.378 |
| H Acceptors | 4 |
| TotalSurfaceArea | 279.77 |
| Relative PSA | 0.14158 |
| PolarSurfaceArea | 45.03 |
| Druglikeness | 4.9632 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (5Z)-5-benzylidene-3-[(Z)-benzylideneamino]-2-phenylimidazol-4-one | 2 - (5Z)-5-benzylidene-3-[(Z)-benzylideneamino]-2-phenylimidazol-4-one