| MolName | [3-benzoyloxy-4-[(Z)-[[2-(2,3-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C29H20N2O6Cl2 |
| Smiles | O=C(COc1cccc(Cl)c1Cl)N/N=C\c(ccc(OC(c1ccccc1)=O)c1)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C29H20Cl2N2O6/c30-23-12-7-13-24(27(23)31)37-18-26(34)33-32-17-21-14-15-22(38-28(35)19-8-3-1-4-9-19)16-25(21)39-29(36)20-10-5-2-6-11-20/h1-17H,18H2,(H,33,34) |
| InChIK | YTYGYHIJUZKPAL-UHFFFAOYSA-N |
| TotalMolweight | 563.392 |
| Molweight | 563.392 |
| MonoisotopicMass | 562.069842 |
| CLogP | 6.8495 |
| CLogS | -7.913 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 416.61 |
| Relative PSA | 0.22105 |
| PolarSurfaceArea | 103.29 |
| Druglikeness | 4.0206 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51282 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [3-benzoyloxy-4-[(Z)-[[2-(2,3-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [3-benzoyloxy-4-[(Z)-[[2-(2,3-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate