| MolName | N-[(Z)-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine |
| MolecularFormula | C19H13N4O3Cl2F |
| Smiles | [O-][N+](c(cc1)cnc1N/N=C\c(cc1Cl)cc(Cl)c1OCc1cc(F)ccc1)=O |
| InChI | InChI=1S/C19H13Cl2FN4O3/c20-16-7-13(9-24-25-18-5-4-15(10-23-18)26(27)28)8-17(21)19(16)29-11-12-2-1-3-14(22)6-12/h1-10H,11H2,(H,23,25) |
| InChIK | YUFUCZMOZACMNA-UHFFFAOYSA-N |
| TotalMolweight | 435.241 |
| Molweight | 435.241 |
| MonoisotopicMass | 434.034873 |
| CLogP | 5.9307 |
| CLogS | -6.466 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 312.38 |
| Relative PSA | 0.23804 |
| PolarSurfaceArea | 92.33 |
| Druglikeness | -4.8551 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine | 2 - N-[(Z)-[3,5-dichloro-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-nitropyridin-2-amine