| MolName | N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-4-nitro-2-(4-phenylpiperidin-1-yl)sulfonylaniline |
| MolecularFormula | C31H26N6O6S3 |
| Smiles | [O-][N+](c(cc1)cc(S(N(CC2)CCC2c2ccccc2)(=O)=O)c1N/N=C\c(cc1)cc([N+]([O-])=O)c1Sc1nc(cccc2)c2s1)=O |
| InChI | InChI=1S/C31H26N6O6S3/c38-36(39)24-11-12-26(30(19-24)46(42,43)35-16-14-23(15-17-35)22-6-2-1-3-7-22)34-32-20-21-10-13-29(27(18-21)37(40)41)45-31-33-25-8-4-5-9-28(25)44-31/h1-13,18-20,23,34H,14-17H2 |
| InChIK | YUWXBJBTLMJOCC-UHFFFAOYSA-N |
| TotalMolweight | 674.781 |
| Molweight | 674.781 |
| MonoisotopicMass | 674.107594 |
| CLogP | 7.2719 |
| CLogS | -8.019 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 475.81 |
| Relative PSA | 0.34627 |
| PolarSurfaceArea | 228.22 |
| Druglikeness | -1.2653 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52174 |
| Fragments | 1 |
| Non HAtoms | 46 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 9 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-4-nitro-2-(4-phenylpiperidin-1-yl)sulfonylaniline | 2 - N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-4-nitro-2-(4-phenylpiperidin-1-yl)sulfonylaniline