| MolName | N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| MolecularFormula | C30H25N3O2 |
| Smiles | OC(C(N/N=C\c1cn(Cc2ccccc2)c2c1cccc2)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H25N3O2/c34-29(30(35,25-14-6-2-7-15-25)26-16-8-3-9-17-26)32-31-20-24-22-33(21-23-12-4-1-5-13-23)28-19-11-10-18-27(24)28/h1-20,22,35H,21H2,(H,32,34) |
| InChIK | YVFRCICITPDZOK-UHFFFAOYSA-N |
| TotalMolweight | 459.548 |
| Molweight | 459.548 |
| MonoisotopicMass | 459.194677 |
| CLogP | 5.0116 |
| CLogS | -5.405 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 360.83 |
| Relative PSA | 0.15514 |
| PolarSurfaceArea | 66.62 |
| Druglikeness | 6.8948 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 3 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide | 2 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide