| MolName | 2-[benzenesulfonyl(pyridin-2-yl)amino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C20H16N4O3Cl2S |
| Smiles | O=C(CN(c1ncccc1)S(c1ccccc1)(=O)=O)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C20H16Cl2N4O3S/c21-17-9-6-10-18(22)16(17)13-24-25-20(27)14-26(19-11-4-5-12-23-19)30(28,29)15-7-2-1-3-8-15/h1-13H,14H2,(H,25,27) |
| InChIK | YVJPCFUSYNZEBS-UHFFFAOYSA-N |
| TotalMolweight | 463.344 |
| Molweight | 463.344 |
| MonoisotopicMass | 462.032015 |
| CLogP | 3.6133 |
| CLogS | -6.128 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 328.99 |
| Relative PSA | 0.24046 |
| PolarSurfaceArea | 100.11 |
| Druglikeness | 0.62679 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[benzenesulfonyl(pyridin-2-yl)amino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide | 2 - 2-[benzenesulfonyl(pyridin-2-yl)amino]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]acetamide