| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C26H22N9O3Cl |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cccc(OCc(cc3)ccc3Cl)c2)=O)c1CNc1ccccc1 |
| InChI | InChI=1S/C26H22ClN9O3/c27-19-11-9-17(10-12-19)16-38-21-8-4-5-18(13-21)14-30-32-26(37)23-22(15-29-20-6-2-1-3-7-20)36(35-31-23)25-24(28)33-39-34-25/h1-14,29H,15-16H2,(H2,28,33)(H,32,37) |
| InChIK | YVJQEUFITASMIQ-UHFFFAOYSA-N |
| TotalMolweight | 543.974 |
| Molweight | 543.974 |
| MonoisotopicMass | 543.153413 |
| CLogP | 4.7686 |
| CLogS | -4.912 |
| H Acceptors | 12 |
| H Donors | 3 |
| TotalSurfaceArea | 413.12 |
| Relative PSA | 0.33308 |
| PolarSurfaceArea | 158.37 |
| Druglikeness | 2.193 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5641 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(anilinomethyl)-N-[(Z)-[3-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]triazole-4-carboxamide