| MolName | 2-(4-chloro-2-nitrophenoxy)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| MolecularFormula | C16H11N4O8Cl |
| Smiles | [O-][N+](c1c(/C=N\NC(COc(ccc(Cl)c2)c2[N+]([O-])=O)=O)cc2OCOc2c1)=O |
| InChI | InChI=1S/C16H11ClN4O8/c17-10-1-2-13(12(4-10)21(25)26)27-7-16(22)19-18-6-9-3-14-15(29-8-28-14)5-11(9)20(23)24/h1-6H,7-8H2,(H,19,22) |
| InChIK | YVTOUQNHKPSKCC-UHFFFAOYSA-N |
| TotalMolweight | 422.736 |
| Molweight | 422.736 |
| MonoisotopicMass | 422.026543 |
| CLogP | 1.6507 |
| CLogS | -5.868 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 293.77 |
| Relative PSA | 0.4318 |
| PolarSurfaceArea | 160.79 |
| Druglikeness | -0.93177 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chloro-2-nitrophenoxy)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide | 2 - 2-(4-chloro-2-nitrophenoxy)-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide