| MolName | (2E)-2-[(Z)-benzylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one |
| MolecularFormula | C17H14N3OFS |
| Smiles | O=C(CS1)N(Cc(cc2)ccc2F)/C1=N\N=C/c1ccccc1 |
| InChI | InChI=1S/C17H14FN3OS/c18-15-8-6-14(7-9-15)11-21-16(22)12-23-17(21)20-19-10-13-4-2-1-3-5-13/h1-10H,11-12H2 |
| InChIK | YWQJIXHGWKYBAB-UHFFFAOYSA-N |
| TotalMolweight | 327.382 |
| Molweight | 327.382 |
| MonoisotopicMass | 327.08416 |
| CLogP | 4.3405 |
| CLogS | -4.786 |
| H Acceptors | 4 |
| TotalSurfaceArea | 246.66 |
| Relative PSA | 0.23149 |
| PolarSurfaceArea | 70.33 |
| Druglikeness | 3.7829 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - (2E)-2-[(Z)-benzylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one | 2 - (2E)-2-[(Z)-benzylidenehydrazinylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one