| MolName | N-[(Z)-[1-[3-(4-chlorophenoxy)propyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C21H19N4OClS |
| Smiles | Clc(cc1)ccc1OCCCn1c(/C=N\Nc2nc(cccc3)c3s2)ccc1 |
| InChI | InChI=1S/C21H19ClN4OS/c22-16-8-10-18(11-9-16)27-14-4-13-26-12-3-5-17(26)15-23-25-21-24-19-6-1-2-7-20(19)28-21/h1-3,5-12,15H,4,13-14H2,(H,24,25) |
| InChIK | YWWMWGYCXRUUJP-UHFFFAOYSA-N |
| TotalMolweight | 410.928 |
| Molweight | 410.928 |
| MonoisotopicMass | 410.096808 |
| CLogP | 6.8877 |
| CLogS | -4.788 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 314.2 |
| Relative PSA | 0.22651 |
| PolarSurfaceArea | 79.68 |
| Druglikeness | 4.5533 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[3-(4-chlorophenoxy)propyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-[1-[3-(4-chlorophenoxy)propyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine