| MolName | 1-(1-adamantyl)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]thiourea |
| MolecularFormula | C18H21N3Cl2S |
| Smiles | S=C(NC1(CC(C2)C3)CC3CC2C1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C18H21Cl2N3S/c19-15-2-1-14(16(20)6-15)10-21-23-17(24)22-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,10-13H,3-5,7-9H2,(H2,22,23,24) |
| InChIK | YWXGSNLDLKUHIP-UHFFFAOYSA-N |
| TotalMolweight | 382.358 |
| Molweight | 382.358 |
| MonoisotopicMass | 381.083321 |
| CLogP | 5.1707 |
| CLogS | -6.621 |
| H Acceptors | 3 |
| H Donors | 2 |
| TotalSurfaceArea | 274.46 |
| Relative PSA | 0.22746 |
| PolarSurfaceArea | 68.51 |
| Druglikeness | 2.9681 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 5 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 1-(1-adamantyl)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]thiourea | 2 - 1-(1-adamantyl)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]thiourea