| MolName | 4-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]naphthalen-1-olate |
| MolecularFormula | C13H8N5O3 |
| Smiles | [O-]c(c1ccccc11)c(/C=N\n2cnnc2)cc1[N+]([O-])=O |
| InChI | InChI=1S/C13H9N5O3/c19-13-9(6-16-17-7-14-15-8-17)5-12(18(20)21)10-3-1-2-4-11(10)13/h1-8,19H/p-1 |
| InChIK | YWXZXJHZQPHIJB-UHFFFAOYSA-M |
| TotalMolweight | 282.239 |
| Molweight | 282.239 |
| MonoisotopicMass | 282.062715 |
| CLogP | -0.4226 |
| CLogS | -6.08 |
| H Acceptors | 8 |
| TotalSurfaceArea | 210.3 |
| Relative PSA | 0.40428 |
| PolarSurfaceArea | 111.95 |
| Druglikeness | -1.7197 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]naphthalen-1-olate | 2 - 4-nitro-2-[(Z)-1,2,4-triazol-4-yliminomethyl]naphthalen-1-olate