| MolName | 3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C21H22N4O2S |
| Smiles | O=C(c1c(N=C2)sc3c1CCCC3)N2/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C21H22N4O2S/c26-21-19-17-3-1-2-4-18(17)28-20(19)22-14-25(21)23-13-15-5-7-16(8-6-15)24-9-11-27-12-10-24/h5-8,13-14H,1-4,9-12H2 |
| InChIK | YXBAVKSTCTYJNC-UHFFFAOYSA-N |
| TotalMolweight | 394.498 |
| Molweight | 394.498 |
| MonoisotopicMass | 394.146346 |
| CLogP | 3.354 |
| CLogS | -5.154 |
| H Acceptors | 6 |
| TotalSurfaceArea | 296.41 |
| Relative PSA | 0.24803 |
| PolarSurfaceArea | 85.74 |
| Druglikeness | 1.5568 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one