| MolName | 4-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C16H11N4O2ClS |
| Smiles | S=C(NN=C1c2ccccc2)N1/N=C\c(cc1OCOc1c1)c1Cl |
| InChI | InChI=1S/C16H11ClN4O2S/c17-12-7-14-13(22-9-23-14)6-11(12)8-18-21-15(19-20-16(21)24)10-4-2-1-3-5-10/h1-8H,9H2,(H,20,24) |
| InChIK | YXDOZDQUFNBPRG-UHFFFAOYSA-N |
| TotalMolweight | 358.808 |
| Molweight | 358.808 |
| MonoisotopicMass | 358.029123 |
| CLogP | 4.0124 |
| CLogS | -5.898 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 257.4 |
| Relative PSA | 0.33423 |
| PolarSurfaceArea | 90.54 |
| Druglikeness | 3.4141 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione