| MolName | N-[(Z)-(4-bromophenyl)methylideneamino]-1H-benzimidazol-2-amine |
| MolecularFormula | C14H11N4Br |
| Smiles | Brc1ccc(/C=N\Nc2nc(cccc3)c3[nH]2)cc1 |
| InChI | InChI=1S/C14H11BrN4/c15-11-7-5-10(6-8-11)9-16-19-14-17-12-3-1-2-4-13(12)18-14/h1-9H,(H2,17,18,19) |
| InChIK | YXGQENKAHJMNLZ-UHFFFAOYSA-N |
| TotalMolweight | 315.173 |
| Molweight | 315.173 |
| MonoisotopicMass | 314.016707 |
| CLogP | 5.5352 |
| CLogS | -4.465 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 210.8 |
| Relative PSA | 0.22737 |
| PolarSurfaceArea | 53.07 |
| Druglikeness | 1.4759 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-bromophenyl)methylideneamino]-1H-benzimidazol-2-amine | 2 - N-[(Z)-(4-bromophenyl)methylideneamino]-1H-benzimidazol-2-amine