| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-5,6-diphenyl-1,2,4-triazin-3-amine |
| MolecularFormula | C22H16N5Cl |
| Smiles | Clc1c(/C=N\Nc2nnc(-c3ccccc3)c(-c3ccccc3)n2)cccc1 |
| InChI | InChI=1S/C22H16ClN5/c23-19-14-8-7-13-18(19)15-24-27-22-25-20(16-9-3-1-4-10-16)21(26-28-22)17-11-5-2-6-12-17/h1-15H,(H,25,27,28) |
| InChIK | YXJTTXKZKUHDPZ-UHFFFAOYSA-N |
| TotalMolweight | 385.857 |
| Molweight | 385.857 |
| MonoisotopicMass | 385.109422 |
| CLogP | 6.9247 |
| CLogS | -6.257 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 300.46 |
| Relative PSA | 0.18598 |
| PolarSurfaceArea | 63.06 |
| Druglikeness | 2.3845 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-5,6-diphenyl-1,2,4-triazin-3-amine | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-5,6-diphenyl-1,2,4-triazin-3-amine