| MolName | 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-3-phenylpropylideneamino]propanamide |
| MolecularFormula | C15H18N6O3 |
| Smiles | O=C(CCNC(C(N1)=O)=NNC1=O)N/N=C\CCc1ccccc1 |
| InChI | InChI=1S/C15H18N6O3/c22-12(8-10-16-13-14(23)18-15(24)21-20-13)19-17-9-4-7-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2,(H,16,20)(H,19,22)(H2,18,21,23,24) |
| InChIK | YXKNWXUZPRURGP-UHFFFAOYSA-N |
| TotalMolweight | 330.347 |
| Molweight | 330.347 |
| MonoisotopicMass | 330.144039 |
| CLogP | -0.0594 |
| CLogS | -3.363 |
| H Acceptors | 9 |
| H Donors | 4 |
| TotalSurfaceArea | 261.62 |
| Relative PSA | 0.41274 |
| PolarSurfaceArea | 124.05 |
| Druglikeness | 5.8597 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-3-phenylpropylideneamino]propanamide | 2 - 3-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-3-phenylpropylideneamino]propanamide