| MolName | 5-[[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl-(4-fluorophenyl)sulfonylamino]methyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide |
| MolecularFormula | C26H22N6O4ClF5S |
| Smiles | O=C(C1=NOC(CN(CCNc(ncc(C(F)(F)F)c2)c2Cl)S(c(cc2)ccc2F)(=O)=O)C1)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C26H22ClF5N6O4S/c27-22-11-17(26(30,31)32)14-34-24(22)33-9-10-38(43(40,41)21-7-5-19(29)6-8-21)15-20-12-23(37-42-20)25(39)36-35-13-16-1-3-18(28)4-2-16/h1-8,11,13-14,20H,9-10,12,15H2,(H,33,34)(H,36,39)/t20-/m1/s1 |
| InChIK | YXNIGENYUQHUAD-HXUWFJFHSA-N |
| TotalMolweight | 645.008 |
| Molweight | 645.008 |
| MonoisotopicMass | 644.103191 |
| CLogP | 4.9477 |
| CLogS | -6.581 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 440.44 |
| Relative PSA | 0.25447 |
| PolarSurfaceArea | 133.73 |
| Druglikeness | 1.3962 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53488 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 17 |
| Electronegative Atoms | 17 |
| StereoCenters | 1 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 5-[[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl-(4-fluorophenyl)sulfonylamino]methyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide | 2 - 5-[[2-[[3-chloro-5-(trifluoromethyl)pyridin-2-yl]amino]ethyl-(4-fluorophenyl)sulfonylamino]methyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide