| MolName | (Z)-1-(2-bromophenyl)-N-piperidin-1-ylmethanimine |
| MolecularFormula | C12H15N2Br |
| Smiles | Brc1c(/C=N\N2CCCCC2)cccc1 |
| InChI | InChI=1S/C12H15BrN2/c13-12-7-3-2-6-11(12)10-14-15-8-4-1-5-9-15/h2-3,6-7,10H,1,4-5,8-9H2 |
| InChIK | YXOIBEOYBAPCPJ-UHFFFAOYSA-N |
| TotalMolweight | 267.169 |
| Molweight | 267.169 |
| MonoisotopicMass | 266.041859 |
| CLogP | 3.3807 |
| CLogS | -3.554 |
| H Acceptors | 2 |
| TotalSurfaceArea | 182.25 |
| Relative PSA | 0.082634 |
| PolarSurfaceArea | 15.6 |
| Druglikeness | 0.4072 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 15 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(2-bromophenyl)-N-piperidin-1-ylmethanimine | 2 - (Z)-1-(2-bromophenyl)-N-piperidin-1-ylmethanimine