| MolName | 4,6-dimorpholin-4-yl-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C17H22N8O2 |
| Smiles | C(COCC1)N1c1nc(N/N=C\c2ncccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H22N8O2/c1-2-4-18-14(3-1)13-19-23-15-20-16(24-5-9-26-10-6-24)22-17(21-15)25-7-11-27-12-8-25/h1-4,13H,5-12H2,(H,20,21,22,23) |
| InChIK | YYDUTROASVFJMN-UHFFFAOYSA-N |
| TotalMolweight | 370.416 |
| Molweight | 370.416 |
| MonoisotopicMass | 370.186572 |
| CLogP | 2.6536 |
| CLogS | -2.77 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 287.96 |
| Relative PSA | 0.32626 |
| PolarSurfaceArea | 100.89 |
| Druglikeness | 3.2985 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-dimorpholin-4-yl-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-dimorpholin-4-yl-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3,5-triazin-2-amine