| MolName | N-[(Z)-benzylideneamino]-2-(2-hydroxyphenoxy)acetamide |
| MolecularFormula | C15H14N2O3 |
| Smiles | Oc(cccc1)c1OCC(N/N=C\c1ccccc1)=O |
| InChI | InChI=1S/C15H14N2O3/c18-13-8-4-5-9-14(13)20-11-15(19)17-16-10-12-6-2-1-3-7-12/h1-10,18H,11H2,(H,17,19) |
| InChIK | YYEKDCQJEJPDBX-UHFFFAOYSA-N |
| TotalMolweight | 270.287 |
| Molweight | 270.287 |
| MonoisotopicMass | 270.100443 |
| CLogP | 2.4308 |
| CLogS | -3.205 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 217.1 |
| Relative PSA | 0.27227 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 4.1816 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-2-(2-hydroxyphenoxy)acetamide | 2 - N-[(Z)-benzylideneamino]-2-(2-hydroxyphenoxy)acetamide