| MolName | N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2,2-diphenylacetamide |
| MolecularFormula | C21H16N2OCl2 |
| Smiles | O=C(C(c1ccccc1)c1ccccc1)N/N=C\c(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C21H16Cl2N2O/c22-18-12-7-13-19(23)17(18)14-24-25-21(26)20(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-14,20H,(H,25,26) |
| InChIK | YZFRLPQRSRZTMG-UHFFFAOYSA-N |
| TotalMolweight | 383.277 |
| Molweight | 383.277 |
| MonoisotopicMass | 382.063967 |
| CLogP | 5.9393 |
| CLogS | -6.307 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 290.09 |
| Relative PSA | 0.12413 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 5.1905 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 11 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2,2-diphenylacetamide | 2 - N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2,2-diphenylacetamide