| MolName | 2,2-bis(4-chlorophenoxy)-N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]acetamide |
| MolecularFormula | C30H22N4O3Cl2 |
| Smiles | O=C(C(Oc(cc1)ccc1Cl)Oc(cc1)ccc1Cl)N/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C30H22Cl2N4O3/c31-23-11-15-26(16-12-23)38-30(39-27-17-13-24(32)14-18-27)29(37)34-33-19-22-20-36(25-9-5-2-6-10-25)35-28(22)21-7-3-1-4-8-21/h1-20,30H,(H,34,37) |
| InChIK | YZOQNWXONFHMSF-UHFFFAOYSA-N |
| TotalMolweight | 557.436 |
| Molweight | 557.436 |
| MonoisotopicMass | 556.106895 |
| CLogP | 6.1452 |
| CLogS | -7.757 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 417.57 |
| Relative PSA | 0.17686 |
| PolarSurfaceArea | 77.74 |
| Druglikeness | 6.0288 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46154 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 3 |
| Symmetricatoms | 14 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,2-bis(4-chlorophenoxy)-N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]acetamide | 2 - 2,2-bis(4-chlorophenoxy)-N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]acetamide