| MolName | 3-chloro-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]aniline |
| MolecularFormula | C13H9N2Cl2F |
| Smiles | Fc1cccc(Cl)c1/C=N\Nc1cc(Cl)ccc1 |
| InChI | InChI=1S/C13H9Cl2FN2/c14-9-3-1-4-10(7-9)18-17-8-11-12(15)5-2-6-13(11)16/h1-8,18H |
| InChIK | ZAUGBOYVNHGFFG-UHFFFAOYSA-N |
| TotalMolweight | 283.132 |
| Molweight | 283.132 |
| MonoisotopicMass | 282.01268 |
| CLogP | 6.1537 |
| CLogS | -4.935 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 206.43 |
| Relative PSA | 0.11127 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | 1.0445 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - 3-chloro-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]aniline | 2 - 3-chloro-N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]aniline