| MolName | 2-[(Z)-benzylideneamino]tetrazol-5-amine |
| MolecularFormula | C8H8N6 |
| Smiles | Nc1nn(/N=C\c2ccccc2)nn1 |
| InChI | InChI=1S/C8H8N6/c9-8-11-13-14(12-8)10-6-7-4-2-1-3-5-7/h1-6H,(H2,9,12) |
| InChIK | ZBJGXBGGJVNUOU-UHFFFAOYSA-N |
| TotalMolweight | 188.194 |
| Molweight | 188.194 |
| MonoisotopicMass | 188.081044 |
| CLogP | 0.8293 |
| CLogS | -2.29 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 151.78 |
| Relative PSA | 0.43853 |
| PolarSurfaceArea | 81.98 |
| Druglikeness | -2.496 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-benzylideneamino]tetrazol-5-amine | 2 - 2-[(Z)-benzylideneamino]tetrazol-5-amine