| MolName | 3-chloro-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| MolecularFormula | C13H7N3Cl3F3 |
| Smiles | FC(c1cc(Cl)c(N/N=C\c(ccc(Cl)c2)c2Cl)nc1)(F)F |
| InChI | InChI=1S/C13H7Cl3F3N3/c14-9-2-1-7(10(15)4-9)5-21-22-12-11(16)3-8(6-20-12)13(17,18)19/h1-6H,(H,20,22) |
| InChIK | ZBNLITJZKSGMGA-UHFFFAOYSA-N |
| TotalMolweight | 368.573 |
| Molweight | 368.573 |
| MonoisotopicMass | 366.965762 |
| CLogP | 6.8577 |
| CLogS | -5.865 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 243.72 |
| Relative PSA | 0.13926 |
| PolarSurfaceArea | 37.28 |
| Druglikeness | -4.8055 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-chloro-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine | 2 - 3-chloro-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine