| MolName | (15S,19R)-17-[(Z)-furan-2-ylmethylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| MolecularFormula | C23H16N2O3 |
| Smiles | O=C([C@H]([C@@H](C1c2c3cccc2)C2=O)C3c3c1cccc3)N2/N=C\c1ccco1 |
| InChI | InChI=1S/C23H16N2O3/c26-22-20-18-14-7-1-2-8-15(14)19(17-10-4-3-9-16(17)18)21(20)23(27)25(22)24-12-13-6-5-11-28-13/h1-12,18-21H/t18?,19?,20-,21-/m1/s1 |
| InChIK | ZBOWLFYYHHLFEU-TZWRJOPASA-N |
| TotalMolweight | 368.391 |
| Molweight | 368.391 |
| MonoisotopicMass | 368.116093 |
| CLogP | 2.2916 |
| CLogS | -4.812 |
| H Acceptors | 5 |
| TotalSurfaceArea | 262.53 |
| Relative PSA | 0.21045 |
| PolarSurfaceArea | 62.88 |
| Druglikeness | 4.5217 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.42857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| StereoCenters | 2 |
| Rotatable Bond | 2 |
| Rings Closures | 6 |
| Small Rings | 7 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon | meso |
Click to Load Molecule:
1 - (15S,19R)-17-[(Z)-furan-2-ylmethylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione | 2 - (15S,19R)-17-[(Z)-furan-2-ylmethylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione