| MolName | (Z)-1-(4-bromophenyl)-N-[(Z)-furan-2-ylmethylideneamino]methanimine |
| MolecularFormula | C12H9N2OBr |
| Smiles | Brc1ccc(/C=N\N=C/c2ccco2)cc1 |
| InChI | InChI=1S/C12H9BrN2O/c13-11-5-3-10(4-6-11)8-14-15-9-12-2-1-7-16-12/h1-9H |
| InChIK | ZBZMEFQLQWZIMH-UHFFFAOYSA-N |
| TotalMolweight | 277.12 |
| Molweight | 277.12 |
| MonoisotopicMass | 275.989824 |
| CLogP | 4.6995 |
| CLogS | -4.648 |
| H Acceptors | 3 |
| TotalSurfaceArea | 190.86 |
| Relative PSA | 0.19454 |
| PolarSurfaceArea | 37.86 |
| Druglikeness | -0.56553 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-bromophenyl)-N-[(Z)-furan-2-ylmethylideneamino]methanimine | 2 - (Z)-1-(4-bromophenyl)-N-[(Z)-furan-2-ylmethylideneamino]methanimine