| MolName | 4-amino-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C19H14N6O2Cl2 |
| Smiles | Nc1nonc1C(N/N=C\c1cn(Cc(ccc(Cl)c2)c2Cl)c2c1cccc2)=O |
| InChI | InChI=1S/C19H14Cl2N6O2/c20-13-6-5-11(15(21)7-13)9-27-10-12(14-3-1-2-4-16(14)27)8-23-24-19(28)17-18(22)26-29-25-17/h1-8,10H,9H2,(H2,22,26)(H,24,28) |
| InChIK | ZCOBLSBOOLEYBD-UHFFFAOYSA-N |
| TotalMolweight | 429.266 |
| Molweight | 429.266 |
| MonoisotopicMass | 428.055528 |
| CLogP | 4.1827 |
| CLogS | -5.039 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 310.88 |
| Relative PSA | 0.30301 |
| PolarSurfaceArea | 111.33 |
| Druglikeness | 7.6907 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide