| MolName | 2-(4-benzylpiperazin-1-yl)-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C20H22N5O3Cl |
| Smiles | [O-][N+](c(cc1)cc(/C=N\NC(CN2CCN(Cc3ccccc3)CC2)=O)c1Cl)=O |
| InChI | InChI=1S/C20H22ClN5O3/c21-19-7-6-18(26(28)29)12-17(19)13-22-23-20(27)15-25-10-8-24(9-11-25)14-16-4-2-1-3-5-16/h1-7,12-13H,8-11,14-15H2,(H,23,27) |
| InChIK | ZCRHOPBSDFOQLF-UHFFFAOYSA-N |
| TotalMolweight | 415.88 |
| Molweight | 415.88 |
| MonoisotopicMass | 415.141117 |
| CLogP | 0.3792 |
| CLogS | -3.762 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 315.74 |
| Relative PSA | 0.23288 |
| PolarSurfaceArea | 93.76 |
| Druglikeness | 4.1423 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amines | 2 |
| AlkylAmines | 2 |
| BasicNitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-benzylpiperazin-1-yl)-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]acetamide | 2 - 2-(4-benzylpiperazin-1-yl)-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]acetamide