| MolName | N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide |
| MolecularFormula | C17H11N3O4ClF3 |
| Smiles | O=C(C(N/N=C\c(cc1)cc2c1OCO2)=O)Nc(cc1)cc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C17H11ClF3N3O4/c18-12-3-2-10(6-11(12)17(19,20)21)23-15(25)16(26)24-22-7-9-1-4-13-14(5-9)28-8-27-13/h1-7H,8H2,(H,23,25)(H,24,26) |
| InChIK | ZCYUIYAFDOHEKE-UHFFFAOYSA-N |
| TotalMolweight | 413.738 |
| Molweight | 413.738 |
| MonoisotopicMass | 413.039018 |
| CLogP | 3.7096 |
| CLogS | -5.75 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 281.34 |
| Relative PSA | 0.28617 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | -3.5943 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide | 2 - N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide