| MolName | 3-bromo-N-[2-[(2Z)-2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| MolecularFormula | C23H19N3O3BrCl |
| Smiles | O=C(CNC(c1cccc(Br)c1)=O)N/N=C\c1cc(OCc(cc2)ccc2Cl)ccc1 |
| InChI | InChI=1S/C23H19BrClN3O3/c24-19-5-2-4-18(12-19)23(30)26-14-22(29)28-27-13-17-3-1-6-21(11-17)31-15-16-7-9-20(25)10-8-16/h1-13H,14-15H2,(H,26,30)(H,28,29) |
| InChIK | ZDQSOHUHSJKYGM-UHFFFAOYSA-N |
| TotalMolweight | 500.779 |
| Molweight | 500.779 |
| MonoisotopicMass | 499.02983 |
| CLogP | 4.9646 |
| CLogS | -6.399 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 347.53 |
| Relative PSA | 0.20289 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 3.2744 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-bromo-N-[2-[(2Z)-2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]benzamide | 2 - 3-bromo-N-[2-[(2Z)-2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxoethyl]benzamide