| MolName | 4-nitro-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C11H8N6O5 |
| Smiles | [O-][N+](c1c(C(N/N=C\c(cc2)ccc2[N+]([O-])=O)=O)[nH]nc1)=O |
| InChI | InChI=1S/C11H8N6O5/c18-11(10-9(17(21)22)6-13-14-10)15-12-5-7-1-3-8(4-2-7)16(19)20/h1-6H,(H,13,14)(H,15,18) |
| InChIK | ZDUJCVYPPTVGEC-UHFFFAOYSA-N |
| TotalMolweight | 304.222 |
| Molweight | 304.222 |
| MonoisotopicMass | 304.055619 |
| CLogP | -0.694 |
| CLogS | -3.238 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 222.66 |
| Relative PSA | 0.54707 |
| PolarSurfaceArea | 161.78 |
| Druglikeness | 0.19335 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-nitro-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide | 2 - 4-nitro-N-[(Z)-(4-nitrophenyl)methylideneamino]-1H-pyrazole-5-carboxamide