| MolName | (Z)-1-[2-(difluoromethoxy)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C10H7N5O3F2 |
| Smiles | [O-][N+](c(cc1)cc(/C=N\n2cnnc2)c1OC(F)F)=O |
| InChI | InChI=1S/C10H7F2N5O3/c11-10(12)20-9-2-1-8(17(18)19)3-7(9)4-15-16-5-13-14-6-16/h1-6,10H |
| InChIK | ZDZCAJINHKJYMZ-UHFFFAOYSA-N |
| TotalMolweight | 283.194 |
| Molweight | 283.194 |
| MonoisotopicMass | 283.051696 |
| CLogP | 0.4761 |
| CLogS | -5.392 |
| H Acceptors | 8 |
| TotalSurfaceArea | 203.37 |
| Relative PSA | 0.39701 |
| PolarSurfaceArea | 98.12 |
| Druglikeness | -4.5865 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[2-(difluoromethoxy)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[2-(difluoromethoxy)-5-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine