| MolName | N'-[(Z)-(3-nitrophenyl)methylideneamino]oxamide |
| MolecularFormula | C9H8N4O4 |
| Smiles | NC(C(N/N=C\c1cccc([N+]([O-])=O)c1)=O)=O |
| InChI | InChI=1S/C9H8N4O4/c10-8(14)9(15)12-11-5-6-2-1-3-7(4-6)13(16)17/h1-5H,(H2,10,14)(H,12,15) |
| InChIK | ZDZOLJATJSMKAR-UHFFFAOYSA-N |
| TotalMolweight | 236.187 |
| Molweight | 236.187 |
| MonoisotopicMass | 236.054556 |
| CLogP | -0.8379 |
| CLogS | -2.562 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 177.17 |
| Relative PSA | 0.53474 |
| PolarSurfaceArea | 130.37 |
| Druglikeness | -2.8756 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(3-nitrophenyl)methylideneamino]oxamide | 2 - N'-[(Z)-(3-nitrophenyl)methylideneamino]oxamide