| MolName | 4-[(Z)-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C23H17N4O3S3 |
| Smiles | [O-]C(c1ccc(/C=N\NC(CSc2nnc(SCc3cccc4ccccc34)s2)=O)cc1)=O |
| InChI | InChI=1S/C23H18N4O3S3/c28-20(25-24-12-15-8-10-17(11-9-15)21(29)30)14-32-23-27-26-22(33-23)31-13-18-6-3-5-16-4-1-2-7-19(16)18/h1-12H,13-14H2,(H,25,28)(H,29,30)/p-1 |
| InChIK | ZEBCFVKKQHQNQU-UHFFFAOYSA-M |
| TotalMolweight | 493.611 |
| Molweight | 493.611 |
| MonoisotopicMass | 493.046276 |
| CLogP | 3.0165 |
| CLogS | -7.959 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 362.59 |
| Relative PSA | 0.38779 |
| PolarSurfaceArea | 186.21 |
| Druglikeness | 5.1443 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoate | 2 - 4-[(Z)-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoate