| MolName | 1-[(Z)-(3-bromophenyl)methylideneamino]-3-phenylthiourea |
| MolecularFormula | C14H12N3BrS |
| Smiles | S=C(Nc1ccccc1)N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C14H12BrN3S/c15-12-6-4-5-11(9-12)10-16-18-14(19)17-13-7-2-1-3-8-13/h1-10H,(H2,17,18,19) |
| InChIK | ZEIIRMLUJIVNPA-UHFFFAOYSA-N |
| TotalMolweight | 334.24 |
| Molweight | 334.24 |
| MonoisotopicMass | 332.993528 |
| CLogP | 4.3174 |
| CLogS | -5.155 |
| H Acceptors | 3 |
| H Donors | 2 |
| TotalSurfaceArea | 232.04 |
| Relative PSA | 0.26905 |
| PolarSurfaceArea | 68.51 |
| Druglikeness | 0.4425 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-(3-bromophenyl)methylideneamino]-3-phenylthiourea | 2 - 1-[(Z)-(3-bromophenyl)methylideneamino]-3-phenylthiourea