| MolName | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-1H-benzimidazol-2-amine |
| MolecularFormula | C18H12N4OCl2 |
| Smiles | Clc(cc1)cc(-c2ccc(/C=N\Nc3nc(cccc4)c4[nH]3)o2)c1Cl |
| InChI | InChI=1S/C18H12Cl2N4O/c19-11-5-7-14(20)13(9-11)17-8-6-12(25-17)10-21-24-18-22-15-3-1-2-4-16(15)23-18/h1-10H,(H2,22,23,24) |
| InChIK | ZEXCXTZLDSKQBP-UHFFFAOYSA-N |
| TotalMolweight | 371.226 |
| Molweight | 371.226 |
| MonoisotopicMass | 370.038815 |
| CLogP | 6.9609 |
| CLogS | -6.563 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 272.46 |
| Relative PSA | 0.2277 |
| PolarSurfaceArea | 66.21 |
| Druglikeness | 5.1443 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-1H-benzimidazol-2-amine | 2 - N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-1H-benzimidazol-2-amine