| MolName | 2-(azocan-1-ium-1-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
| MolecularFormula | C16H23N3OF |
| Smiles | O=C(C[NH+]1CCCCCCC1)N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C16H22FN3O/c17-15-9-5-4-8-14(15)12-18-19-16(21)13-20-10-6-2-1-3-7-11-20/h4-5,8-9,12H,1-3,6-7,10-11,13H2,(H,19,21)/p+1 |
| InChIK | ZEXLTDFPDRXTGC-UHFFFAOYSA-O |
| TotalMolweight | 292.377 |
| Molweight | 292.377 |
| MonoisotopicMass | 292.182515 |
| CLogP | 1.8932 |
| CLogS | -3.484 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 254.5 |
| Relative PSA | 0.21061 |
| PolarSurfaceArea | 45.9 |
| Druglikeness | -2.6541 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 9 |
| Symmetricatoms | 3 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(azocan-1-ium-1-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide | 2 - 2-(azocan-1-ium-1-yl)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide