| MolName | 3-phenyl-4-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C15H9N4OBr3S |
| Smiles | Oc(c(Br)cc(Br)c1C=NN(C(c2ccccc2)=NN2)C2=S)c1Br |
| InChI | InChI=1S/C15H9Br3N4OS/c16-10-6-11(17)13(23)12(18)9(10)7-19-22-14(20-21-15(22)24)8-4-2-1-3-5-8/h1-7,23H,(H,21,24) |
| InChIK | ZEZCBQRHYPXYGH-UHFFFAOYSA-N |
| TotalMolweight | 533.041 |
| Molweight | 533.041 |
| MonoisotopicMass | 529.804714 |
| CLogP | 5.1249 |
| CLogS | -6.657 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 283.96 |
| Relative PSA | 0.27867 |
| PolarSurfaceArea | 92.31 |
| Druglikeness | 1.7119 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea; polyhalo aromatic ring |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-phenyl-4-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-phenyl-4-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione