| MolName | N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-2-(2,4-dioxo-1H-pyrimidin-6-yl)acetamide |
| MolecularFormula | C15H13N4O3Br |
| Smiles | O=C(CC(NC(N1)=O)=CC1=O)N/N=C\C(\Br)=C\c1ccccc1 |
| InChI | InChI=1S/C15H13BrN4O3/c16-11(6-10-4-2-1-3-5-10)9-17-20-14(22)8-12-7-13(21)19-15(23)18-12/h1-7,9H,8H2,(H,20,22)(H2,18,19,21,23) |
| InChIK | ZEZNIHITKQXGJJ-UHFFFAOYSA-N |
| TotalMolweight | 377.197 |
| Molweight | 377.197 |
| MonoisotopicMass | 376.017102 |
| CLogP | 1.4738 |
| CLogS | -4.47 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 253.96 |
| Relative PSA | 0.33474 |
| PolarSurfaceArea | 99.66 |
| Druglikeness | -1.035 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-2-(2,4-dioxo-1H-pyrimidin-6-yl)acetamide | 2 - N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-2-(2,4-dioxo-1H-pyrimidin-6-yl)acetamide